C19H17Cl2F3N4O3 — CID 23152003
2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexyl]-5-nitrobenzamide (PubChem CID 23152003) has the molecular formula C19H17Cl2F3N4O3 and a molecular weight of 477.27 g/mol. Its IUPAC name is 2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 23152003 |
| Molecular Formula | C19H17Cl2F3N4O3 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-chloro-N-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]cyclohexyl]-5-nitrobenzamide |
| SMILES | O=C(NC1CCC(Nc2ncc(C(F)(F)F)cc2Cl)CC1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H17Cl2F3N4O3/c20-15-6-5-13(28(30)31)8-14(15)18(29)27-12-3-1-11(2-4-12)26-17-16(21)7-10(9-25-17)19(22,23)24/h5-9,11-12H,1-4H2,(H,25,26)(H,27,29) |
| InChIKey | JRDZAXCFEMVAOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|