C18H19ClN2O4 — CID 112975181
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-(2-chloro-4,6-dimethylphenyl)urea (PubChem CID 112975181) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-(2-chloro-4,6-dimethylphenyl)urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-(2-chloro-4,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 112975181 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-(2-chloro-4,6-dimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NCCOc2ccc3c(c2)OCO3)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-11-7-12(2)17(14(19)8-11)21-18(22)20-5-6-23-13-3-4-15-16(9-13)25-10-24-15/h3-4,7-9H,5-6,10H2,1-2H3,(H2,20,21,22) |
| InChIKey | NCOFSUNUURJLPQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|