C18H18ClNO4 — CID 113103071
N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 113103071) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 113103071 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cc(OCCNC(=O)c2ccc3c(c2)OCO3)cc(C)c1Cl |
| InChI | InChI=1S/C18H18ClNO4/c1-11-7-14(8-12(2)17(11)19)22-6-5-20-18(21)13-3-4-15-16(9-13)24-10-23-15/h3-4,7-9H,5-6,10H2,1-2H3,(H,20,21) |
| InChIKey | ATGIUVXSVUGAQK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|