C20H18Cl2F3N3O4 — CID 35184424
N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 35184424) has the molecular formula C20H18Cl2F3N3O4 and a molecular weight of 492.28 g/mol. Its IUPAC name is N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 35184424 |
| Molecular Formula | C20H18Cl2F3N3O4 |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18Cl2F3N3O4/c21-14-7-8-16(15(22)10-14)32-9-1-2-17(29)27-28-18(30)11-26-19(31)12-3-5-13(6-4-12)20(23,24)25/h3-8,10H,1-2,9,11H2,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | IGIMYZGEFLCZJU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|