C23H21Cl2N3O4 — CID 24538219
N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]naphthalene-2-carboxamide (PubChem CID 24538219) has the molecular formula C23H21Cl2N3O4 and a molecular weight of 474.34 g/mol. Its IUPAC name is N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 24538219 |
| Molecular Formula | C23H21Cl2N3O4 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | N-[2-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-2-oxoethyl]naphthalene-2-carboxamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)CNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H21Cl2N3O4/c24-18-9-10-20(19(25)13-18)32-11-3-6-21(29)27-28-22(30)14-26-23(31)17-8-7-15-4-1-2-5-16(15)12-17/h1-2,4-5,7-10,12-13H,3,6,11,14H2,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | WRBMULCQLDYYSF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|