C16H26N2O3S — CID 3391312
N-[4-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 3391312) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[4-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 3391312 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[4-(tert-butylsulfamoyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-15(2,3)11-14(19)17-12-7-9-13(10-8-12)22(20,21)18-16(4,5)6/h7-10,18H,11H2,1-6H3,(H,17,19) |
| InChIKey | MDRKOVQDYYKYMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |