C15H18N4O3S2 — CID 4136730
1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-prop-2-enylthiourea (PubChem CID 4136730) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4136730 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 |
| InChI | InChI=1S/C15H18N4O3S2/c1-4-9-16-15(23)17-12-5-7-13(8-6-12)24(20,21)19-14-10(2)11(3)18-22-14/h4-8,19H,1,9H2,2-3H3,(H2,16,17,23) |
| InChIKey | YTLXLQWQQGLSNT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|