C24H22N4O4S2 — CID 25035426
1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 25035426) has the molecular formula C24H22N4O4S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 25035426 |
| Molecular Formula | C24H22N4O4S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=S)Nc3ccc(Oc4ccccc4)cc3)cc2)c1C |
| InChI | InChI=1S/C24H22N4O4S2/c1-16-17(2)27-32-23(16)28-34(29,30)22-14-10-19(11-15-22)26-24(33)25-18-8-12-21(13-9-18)31-20-6-4-3-5-7-20/h3-15,28H,1-2H3,(H2,25,26,33) |
| InChIKey | OBARTGGJWWOGDF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|