C19H19N3O5S — CID 659894
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-phenoxyacetamide (PubChem CID 659894) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 659894 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-phenoxyacetamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)COc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C19H19N3O5S/c1-13-14(2)21-27-19(13)22-28(24,25)17-10-8-15(9-11-17)20-18(23)12-26-16-6-4-3-5-7-16/h3-11,22H,12H2,1-2H3,(H,20,23) |
| InChIKey | VGOZUCJZCVKAHW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |