C14H18F3N3O3 — CID 87000141
N-ethyl-2-[2-[4-(trifluoromethoxy)phenyl]ethylcarbamoylamino]acetamide (PubChem CID 87000141) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is N-ethyl-2-[2-[4-(trifluoromethoxy)phenyl]ethylcarbamoylamino]acetamide.
| Compound Name | N-ethyl-2-[2-[4-(trifluoromethoxy)phenyl]ethylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 87000141 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-ethyl-2-[2-[4-(trifluoromethoxy)phenyl]ethylcarbamoylamino]acetamide |
| SMILES | CCNC(=O)CNC(=O)NCCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3N3O3/c1-2-18-12(21)9-20-13(22)19-8-7-10-3-5-11(6-4-10)23-14(15,16)17/h3-6H,2,7-9H2,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | KAGIRIVZVBVHAP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |