C18H21N3O5 — CID 87384431
4-[2-[(2,4-dimethoxyphenyl)carbamoylamino]ethyl]-N-hydroxybenzamide (PubChem CID 87384431) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-[2-[(2,4-dimethoxyphenyl)carbamoylamino]ethyl]-N-hydroxybenzamide.
| Compound Name | 4-[2-[(2,4-dimethoxyphenyl)carbamoylamino]ethyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87384431 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[2-[(2,4-dimethoxyphenyl)carbamoylamino]ethyl]-N-hydroxybenzamide |
| SMILES | COc1ccc(NC(=O)NCCc2ccc(C(=O)NO)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O5/c1-25-14-7-8-15(16(11-14)26-2)20-18(23)19-10-9-12-3-5-13(6-4-12)17(22)21-24/h3-8,11,24H,9-10H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | CJEWJTVSXZMQCS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|