C19H21FN2O4S — CID 2496418
5-[(2-fluorophenyl)sulfamoyl]-2-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 2496418) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)sulfamoyl]-2-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-[(2-fluorophenyl)sulfamoyl]-2-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2496418 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 5-[(2-fluorophenyl)sulfamoyl]-2-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2F)cc1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-13-8-9-15(27(24,25)22-18-7-3-2-6-17(18)20)11-16(13)19(23)21-12-14-5-4-10-26-14/h2-3,6-9,11,14,22H,4-5,10,12H2,1H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | LXLFWPQLKQBJLN-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |