C11H14ClNO3S — CID 59878668
N-[5-(3-chloro-2-oxopropyl)-2-methylphenyl]methanesulfonamide (PubChem CID 59878668) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is N-[5-(3-chloro-2-oxopropyl)-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[5-(3-chloro-2-oxopropyl)-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59878668 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-[5-(3-chloro-2-oxopropyl)-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1ccc(CC(=O)CCl)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C11H14ClNO3S/c1-8-3-4-9(5-10(14)7-12)6-11(8)13-17(2,15)16/h3-4,6,13H,5,7H2,1-2H3 |
| InChIKey | GJMHPIWCCMWROO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|