C18H13F2N3O2S — CID 22774852
3,4-difluoro-N-(4-phenyldiazenylphenyl)benzenesulfonamide (PubChem CID 22774852) has the molecular formula C18H13F2N3O2S and a molecular weight of 373.38 g/mol. Its IUPAC name is 3,4-difluoro-N-(4-phenyldiazenylphenyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(4-phenyldiazenylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22774852 |
| Molecular Formula | C18H13F2N3O2S |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 3,4-difluoro-N-(4-phenyldiazenylphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(/N=N/c2ccccc2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H13F2N3O2S/c19-17-11-10-16(12-18(17)20)26(24,25)23-15-8-6-14(7-9-15)22-21-13-4-2-1-3-5-13/h1-12,23H/b22-21+ |
| InChIKey | NHJFRRJOZXTXLN-QURGRASLSA-N |
| XLogP | 5.18 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|