C19H21ClN2O5S — CID 3193347
N-(5-chloro-2-methoxyphenyl)-4-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 3193347) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-4-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 3193347 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-26-18-9-6-14(20)11-17(18)22-19(23)13-4-7-16(8-5-13)28(24,25)21-12-15-3-2-10-27-15/h4-9,11,15,21H,2-3,10,12H2,1H3,(H,22,23) |
| InChIKey | MVIYDBZQTDEDLO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |