C18H18Cl2N2O4S — CID 25490032
N-(2,3-dichlorophenyl)-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 25490032) has the molecular formula C18H18Cl2N2O4S and a molecular weight of 429.33 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 25490032 |
| Molecular Formula | C18H18Cl2N2O4S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O4S/c19-15-4-1-5-16(17(15)20)22-18(23)12-6-8-14(9-7-12)27(24,25)21-11-13-3-2-10-26-13/h1,4-9,13,21H,2-3,10-11H2,(H,22,23)/t13-/m0/s1 |
| InChIKey | NDYGTLQFZIINDT-ZDUSSCGKSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |