C15H21ClN2O5S — CID 7477015
(2S)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]propanamide (PubChem CID 7477015) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 7477015 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2S)-2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-[[(2R)-oxolan-2-yl]methyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NC[C@H]2CCCO2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O5S/c1-10(15(19)17-9-11-4-3-7-23-11)18-24(20,21)12-5-6-14(22-2)13(16)8-12/h5-6,8,10-11,18H,3-4,7,9H2,1-2H3,(H,17,19)/t10-,11+/m0/s1 |
| InChIKey | WRAMYZZWTHHSDK-WDEREUQCSA-N |
| XLogP | 1.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |