C20H29ClN2O5 — CID 55719039
N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 55719039) has the molecular formula C20H29ClN2O5 and a molecular weight of 412.91 g/mol. Its IUPAC name is N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 55719039 |
| Molecular Formula | C20H29ClN2O5 |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CCN(CC)C(=O)COc1ccc(NC(=O)CCOCC2CCCO2)cc1Cl |
| InChI | InChI=1S/C20H29ClN2O5/c1-3-23(4-2)20(25)14-28-18-8-7-15(12-17(18)21)22-19(24)9-11-26-13-16-6-5-10-27-16/h7-8,12,16H,3-6,9-11,13-14H2,1-2H3,(H,22,24) |
| InChIKey | WYAXERQEVOYULY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|