C17H26ClN3O4 — CID 120588524
4-amino-N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-methoxybutanamide (PubChem CID 120588524) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is 4-amino-N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120588524 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-amino-N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3-methoxybutanamide |
| SMILES | CCN(CC)C(=O)COc1ccc(NC(=O)CC(CN)OC)cc1Cl |
| InChI | InChI=1S/C17H26ClN3O4/c1-4-21(5-2)17(23)11-25-15-7-6-12(8-14(15)18)20-16(22)9-13(10-19)24-3/h6-8,13H,4-5,9-11,19H2,1-3H3,(H,20,22) |
| InChIKey | KSDOFULDSCMRKT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |