C21H23BrClN3O4 — CID 46423639
3-bromo-N-[2-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]anilino]-2-oxoethyl]benzamide (PubChem CID 46423639) has the molecular formula C21H23BrClN3O4 and a molecular weight of 496.79 g/mol. Its IUPAC name is 3-bromo-N-[2-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]anilino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46423639 |
| Molecular Formula | C21H23BrClN3O4 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 3-bromo-N-[2-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]anilino]-2-oxoethyl]benzamide |
| SMILES | CCN(CC)C(=O)COc1ccc(NC(=O)CNC(=O)c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C21H23BrClN3O4/c1-3-26(4-2)20(28)13-30-18-9-8-16(11-17(18)23)25-19(27)12-24-21(29)14-6-5-7-15(22)10-14/h5-11H,3-4,12-13H2,1-2H3,(H,24,29)(H,25,27) |
| InChIKey | ULMYAYZBLYIKGQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |