C19H19ClF2N2O3 — CID 39171469
N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3,4-difluorobenzamide (PubChem CID 39171469) has the molecular formula C19H19ClF2N2O3 and a molecular weight of 396.82 g/mol. Its IUPAC name is N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 39171469 |
| Molecular Formula | C19H19ClF2N2O3 |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-chloro-4-[2-(diethylamino)-2-oxoethoxy]phenyl]-3,4-difluorobenzamide |
| SMILES | CCN(CC)C(=O)COc1ccc(NC(=O)c2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C19H19ClF2N2O3/c1-3-24(4-2)18(25)11-27-17-8-6-13(10-14(17)20)23-19(26)12-5-7-15(21)16(22)9-12/h5-10H,3-4,11H2,1-2H3,(H,23,26) |
| InChIKey | AEEHDCZTRSVOPD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |