C15H22ClN3O3 — CID 120590141
4-[(4-amino-3-methoxybutanoyl)amino]-2-chloro-N-propylbenzamide (PubChem CID 120590141) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 4-[(4-amino-3-methoxybutanoyl)amino]-2-chloro-N-propylbenzamide.
| Compound Name | 4-[(4-amino-3-methoxybutanoyl)amino]-2-chloro-N-propylbenzamide |
|---|---|
| PubChem CID | 120590141 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-[(4-amino-3-methoxybutanoyl)amino]-2-chloro-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(NC(=O)CC(CN)OC)cc1Cl |
| InChI | InChI=1S/C15H22ClN3O3/c1-3-6-18-15(21)12-5-4-10(7-13(12)16)19-14(20)8-11(9-17)22-2/h4-5,7,11H,3,6,8-9,17H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | HTGLUUDVZAOLBM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |