C16H18ClN3O4 — CID 120589860
N-[4-[(4-amino-3-methoxybutanoyl)amino]-2-chlorophenyl]furan-2-carboxamide (PubChem CID 120589860) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-[4-[(4-amino-3-methoxybutanoyl)amino]-2-chlorophenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(4-amino-3-methoxybutanoyl)amino]-2-chlorophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 120589860 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[4-[(4-amino-3-methoxybutanoyl)amino]-2-chlorophenyl]furan-2-carboxamide |
| SMILES | COC(CN)CC(=O)Nc1ccc(NC(=O)c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O4/c1-23-11(9-18)8-15(21)19-10-4-5-13(12(17)7-10)20-16(22)14-3-2-6-24-14/h2-7,11H,8-9,18H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | PLCQSAHNIYHHPW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |