C19H20Cl2N2O4 — CID 78882748
N-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 78882748) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is N-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 78882748 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl]-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | O=C(CCOCC1CCCO1)Nc1ccc(Oc2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O4/c20-13-10-17(21)19(22-11-13)27-15-5-3-14(4-6-15)23-18(24)7-9-25-12-16-2-1-8-26-16/h3-6,10-11,16H,1-2,7-9,12H2,(H,23,24) |
| InChIKey | ONSIUMNATJSRTI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|