C13H10F2N2OS3 — CID 3581206
N-[[3-(difluoromethylsulfanyl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 3581206) has the molecular formula C13H10F2N2OS3 and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[[3-(difluoromethylsulfanyl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[3-(difluoromethylsulfanyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3581206 |
| Molecular Formula | C13H10F2N2OS3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N-[[3-(difluoromethylsulfanyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(SC(F)F)c1)c1cccs1 |
| InChI | InChI=1S/C13H10F2N2OS3/c14-12(15)21-9-4-1-3-8(7-9)16-13(19)17-11(18)10-5-2-6-20-10/h1-7,12H,(H2,16,17,18,19) |
| InChIKey | LZSKUOWVLOJSBQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|