C23H22N2O4S2 — CID 18906305
methyl 2-[2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylbutanoylamino]benzoate (PubChem CID 18906305) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is methyl 2-[2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylbutanoylamino]benzoate.
| Compound Name | methyl 2-[2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 18906305 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | methyl 2-[2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylbutanoylamino]benzoate |
| SMILES | CCC(Sc1cccc(NC(=O)c2cccs2)c1)C(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C23H22N2O4S2/c1-3-19(21(26)25-18-11-5-4-10-17(18)23(28)29-2)31-16-9-6-8-15(14-16)24-22(27)20-12-7-13-30-20/h4-14,19H,3H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | XJIBNVPQIXEPOE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |