C14H13ClN2O2S — CID 17361581
(E)-3-(5-chloro-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 17361581) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is (E)-3-(5-chloro-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17361581 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (E)-3-(5-chloro-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1/C=C/C(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C14H13ClN2O2S/c1-9-8-20-14(16-9)17-13(18)6-3-10-7-11(15)4-5-12(10)19-2/h3-8H,1-2H3,(H,16,17,18)/b6-3+ |
| InChIKey | WVSDDSJTCJPWGQ-ZZXKWVIFSA-N |
| XLogP | 3.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|