C16H20ClFN2O2 — CID 163757396
(E,2R)-6-(4-chloro-2-fluorophenyl)-2-(2-methylpropyl)-4-oxohex-5-enehydrazide (PubChem CID 163757396) has the molecular formula C16H20ClFN2O2 and a molecular weight of 326.80 g/mol. Its IUPAC name is (E,2R)-6-(4-chloro-2-fluorophenyl)-2-(2-methylpropyl)-4-oxohex-5-enehydrazide.
| Compound Name | (E,2R)-6-(4-chloro-2-fluorophenyl)-2-(2-methylpropyl)-4-oxohex-5-enehydrazide |
|---|---|
| PubChem CID | 163757396 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (E,2R)-6-(4-chloro-2-fluorophenyl)-2-(2-methylpropyl)-4-oxohex-5-enehydrazide |
| SMILES | CC(C)C[C@H](CC(=O)/C=C/c1ccc(Cl)cc1F)C(=O)NN |
| InChI | InChI=1S/C16H20ClFN2O2/c1-10(2)7-12(16(22)20-19)8-14(21)6-4-11-3-5-13(17)9-15(11)18/h3-6,9-10,12H,7-8,19H2,1-2H3,(H,20,22)/b6-4+/t12-/m1/s1 |
| InChIKey | LVGDSVHFKQKRPS-FVOPLDGLSA-N |
| XLogP | 3.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|