C15H15ClFNO3 — CID 43172580
2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-2-cyclopropylpropanoic acid (PubChem CID 43172580) has the molecular formula C15H15ClFNO3 and a molecular weight of 311.74 g/mol. Its IUPAC name is 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-2-cyclopropylpropanoic acid.
| Compound Name | 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-2-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 43172580 |
| Molecular Formula | C15H15ClFNO3 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-2-cyclopropylpropanoic acid |
| SMILES | CC(NC(=O)/C=C/c1c(F)cccc1Cl)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C15H15ClFNO3/c1-15(14(20)21,9-5-6-9)18-13(19)8-7-10-11(16)3-2-4-12(10)17/h2-4,7-9H,5-6H2,1H3,(H,18,19)(H,20,21)/b8-7+ |
| InChIKey | RTHHRLNKFYMOKN-BQYQJAHWSA-N |
| XLogP | 2.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|