C20H21FN2O3 — CID 24566001
N'-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 24566001) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is N'-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | N'-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 24566001 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N'-[(E)-3-(2,4-dimethylphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)C(C)Oc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C20H21FN2O3/c1-13-4-5-16(14(2)12-13)6-11-19(24)22-23-20(25)15(3)26-18-9-7-17(21)8-10-18/h4-12,15H,1-3H3,(H,22,24)(H,23,25)/b11-6+ |
| InChIKey | MKFKRAFMVCYZEA-IZZDOVSWSA-N |
| XLogP | 3.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|