C18H21N3OS2 — CID 9160587
1-(4-butylphenyl)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea (PubChem CID 9160587) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9160587 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-(4-butylphenyl)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C18H21N3OS2/c1-2-3-5-14-7-9-15(10-8-14)19-18(23)21-20-17(22)12-11-16-6-4-13-24-16/h4,6-13H,2-3,5H2,1H3,(H,20,22)(H2,19,21,23)/b12-11+ |
| InChIKey | FRFQYFLDWORPEH-VAWYXSNFSA-N |
| XLogP | 4.12 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|