C19H18BrFN2O2 — CID 55770244
3-[[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]methyl]-N-ethylbenzamide (PubChem CID 55770244) has the molecular formula C19H18BrFN2O2 and a molecular weight of 405.27 g/mol. Its IUPAC name is 3-[[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]methyl]-N-ethylbenzamide.
| Compound Name | 3-[[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 55770244 |
| Molecular Formula | C19H18BrFN2O2 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 3-[[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(CNC(=O)/C=C/c2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C19H18BrFN2O2/c1-2-22-19(25)15-5-3-4-13(10-15)12-23-18(24)9-6-14-11-16(20)7-8-17(14)21/h3-11H,2,12H2,1H3,(H,22,25)(H,23,24)/b9-6+ |
| InChIKey | CXJFCVOHNXBYNM-RMKNXTFCSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|