C20H22BrFN2O2 — CID 55337279
3-(5-bromo-2-fluorophenyl)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 55337279) has the molecular formula C20H22BrFN2O2 and a molecular weight of 421.31 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | 3-(5-bromo-2-fluorophenyl)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55337279 |
| Molecular Formula | C20H22BrFN2O2 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1cccc(C(CNC(=O)C=Cc2cc(Br)ccc2F)N(C)C)c1 |
| InChI | InChI=1S/C20H22BrFN2O2/c1-24(2)19(15-5-4-6-17(12-15)26-3)13-23-20(25)10-7-14-11-16(21)8-9-18(14)22/h4-12,19H,13H2,1-3H3,(H,23,25) |
| InChIKey | YZFOLMVAXVZUPN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|