C21H25FN2O3 — CID 43072507
(E)-3-(3,5-dimethoxyphenyl)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 43072507) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 43072507 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(c2cccc(F)c2)N(C)C)cc(OC)c1 |
| InChI | InChI=1S/C21H25FN2O3/c1-24(2)20(16-6-5-7-17(22)12-16)14-23-21(25)9-8-15-10-18(26-3)13-19(11-15)27-4/h5-13,20H,14H2,1-4H3,(H,23,25)/b9-8+ |
| InChIKey | SSEORMPXGQMYQK-CMDGGOBGSA-N |
| XLogP | 3.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|