C20H21F3N2O2 — CID 39957610
(E)-3-[2-(difluoromethoxy)phenyl]-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 39957610) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 39957610 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | CN(C)[C@H](CNC(=O)/C=C/c1ccccc1OC(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C20H21F3N2O2/c1-25(2)17(15-7-5-8-16(21)12-15)13-24-19(26)11-10-14-6-3-4-9-18(14)27-20(22)23/h3-12,17,20H,13H2,1-2H3,(H,24,26)/b11-10+/t17-/m1/s1 |
| InChIKey | DDEIPKWVPOHMNH-SXSDINLZSA-N |
| XLogP | 3.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|