C15H14N4O3 — CID 31638485
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 31638485) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 31638485 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2nc[nH]c2c1)NCc1ccco1 |
| InChI | InChI=1S/C15H14N4O3/c20-14(16-7-11-2-1-5-22-11)8-17-15(21)10-3-4-12-13(6-10)19-9-18-12/h1-6,9H,7-8H2,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | OTQFYEHLGWEBKV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |