C14H11NO5 — CID 94282177
2-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide (PubChem CID 94282177) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 94282177 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-2-oxoacetamide |
| SMILES | O=C(NCc1ccco1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H11NO5/c16-13(14(17)15-7-10-2-1-5-18-10)9-3-4-11-12(6-9)20-8-19-11/h1-6H,7-8H2,(H,15,17) |
| InChIKey | PZSCUTWKRQSBOQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|