C14H13NO5 — CID 84748399
2-(1,3-benzodioxol-5-yl)-2-(furan-2-ylmethylamino)acetic acid (PubChem CID 84748399) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-(furan-2-ylmethylamino)acetic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-(furan-2-ylmethylamino)acetic acid |
|---|---|
| PubChem CID | 84748399 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-(furan-2-ylmethylamino)acetic acid |
| SMILES | O=C(O)C(NCc1ccco1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13NO5/c16-14(17)13(15-7-10-2-1-5-18-10)9-3-4-11-12(6-9)20-8-19-11/h1-6,13,15H,7-8H2,(H,16,17) |
| InChIKey | NKMAHTPYJJPTAA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |