C20H15NO6S — CID 9323674
4-[4-[(2-thiophen-2-ylacetyl)amino]phenoxy]phthalic acid (PubChem CID 9323674) has the molecular formula C20H15NO6S and a molecular weight of 397.41 g/mol. Its IUPAC name is 4-[4-[(2-thiophen-2-ylacetyl)amino]phenoxy]phthalic acid.
| Compound Name | 4-[4-[(2-thiophen-2-ylacetyl)amino]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 9323674 |
| Molecular Formula | C20H15NO6S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-[4-[(2-thiophen-2-ylacetyl)amino]phenoxy]phthalic acid |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H15NO6S/c22-18(11-15-2-1-9-28-15)21-12-3-5-13(6-4-12)27-14-7-8-16(19(23)24)17(10-14)20(25)26/h1-10H,11H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | TZBAGQOJIYWPGK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |