C14H14F3N2O2S+ — CID 7450766
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 7450766) has the molecular formula C14H14F3N2O2S+ and a molecular weight of 331.34 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7450766 |
| Molecular Formula | C14H14F3N2O2S+ |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | O=C(C[NH2+]Cc1cccs1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N2O2S/c15-14(16,17)21-11-5-3-10(4-6-11)19-13(20)9-18-8-12-2-1-7-22-12/h1-7,18H,8-9H2,(H,19,20)/p+1 |
| InChIKey | RUMJUAIXUDFUGV-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |