C15H15F3N2O2S — CID 25411323
(2S)-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethoxy)anilino]propanamide (PubChem CID 25411323) has the molecular formula C15H15F3N2O2S and a molecular weight of 344.36 g/mol. Its IUPAC name is (2S)-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethoxy)anilino]propanamide.
| Compound Name | (2S)-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethoxy)anilino]propanamide |
|---|---|
| PubChem CID | 25411323 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2S)-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethoxy)anilino]propanamide |
| SMILES | C[C@H](Nc1ccc(OC(F)(F)F)cc1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H15F3N2O2S/c1-10(14(21)19-9-13-3-2-8-23-13)20-11-4-6-12(7-5-11)22-15(16,17)18/h2-8,10,20H,9H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | WFQBYPHJXDKZIN-JTQLQIEISA-N |
| XLogP | 3.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|