C16H23NO4 — CID 103868338
methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)hexanoate (PubChem CID 103868338) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)hexanoate.
| Compound Name | methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)hexanoate |
|---|---|
| PubChem CID | 103868338 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)hexanoate |
| SMILES | CCCCC(Nc1ccc2c(c1)OCCCO2)C(=O)OC |
| InChI | InChI=1S/C16H23NO4/c1-3-4-6-13(16(18)19-2)17-12-7-8-14-15(11-12)21-10-5-9-20-14/h7-8,11,13,17H,3-6,9-10H2,1-2H3 |
| InChIKey | CGZQXGZCVQKWFW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|