C20H21N3O4 — CID 4906817
2-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-3-methylpentanoic acid (PubChem CID 4906817) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 4906817 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)Nc1cccc(-c2nc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C20H21N3O4/c1-3-12(2)17(19(24)25)23-20(26)21-14-8-6-7-13(11-14)18-22-15-9-4-5-10-16(15)27-18/h4-12,17H,3H2,1-2H3,(H,24,25)(H2,21,23,26) |
| InChIKey | BKOFIZJEIBKKCA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |