C23H20N2O2 — CID 7596926
N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 7596926) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 7596926 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2cccc(-c3nc4ccccc4o3)c2)c(C)c1 |
| InChI | InChI=1S/C23H20N2O2/c1-15-10-11-17(16(2)12-15)14-22(26)24-19-7-5-6-18(13-19)23-25-20-8-3-4-9-21(20)27-23/h3-13H,14H2,1-2H3,(H,24,26) |
| InChIKey | OXTFQIUTNUKJOQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |