C10H12N2O2S — CID 14015035
2-methylpropyl N-(3-cyanothiophen-2-yl)carbamate (PubChem CID 14015035) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-methylpropyl N-(3-cyanothiophen-2-yl)carbamate.
| Compound Name | 2-methylpropyl N-(3-cyanothiophen-2-yl)carbamate |
|---|---|
| PubChem CID | 14015035 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-methylpropyl N-(3-cyanothiophen-2-yl)carbamate |
| SMILES | CC(C)COC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C10H12N2O2S/c1-7(2)6-14-10(13)12-9-8(5-11)3-4-15-9/h3-4,7H,6H2,1-2H3,(H,12,13) |
| InChIKey | YDNWCTCOCIADOS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |