About 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate
2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate (PubChem CID 43551360) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate |
| PubChem CID | 43551360 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate |
| SMILES | CC(C)COC(=O)Nc1ccc(N)cc1C#N |
| InChI | InChI=1S/C12H15N3O2/c1-8(2)7-17-12(16)15-11-4-3-10(14)5-9(11)6-13/h3-5,8H,7,14H2,1-2H3,(H,15,16) |
| InChIKey | QHAFYKLWMFJARB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate?
The IUPAC name of 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate (CID 43551360) is 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate.
What is the SMILES notation for 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate?
The canonical SMILES for 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate is CC(C)COC(=O)Nc1ccc(N)cc1C#N.
What is the InChIKey of 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate?
The InChIKey is QHAFYKLWMFJARB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-8(2)7-17-12(16)15-11-4-3-10(14)5-9(11)6-13/h3-5,8H,7,14H2,1-2H3,(H,15,16).
What are the key properties of 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate?
2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate has a molecular weight of 233.27 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-(4-amino-2-cyanophenyl)carbamate is sourced from PubChem (CID 43551360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).