C11H17NO3 — CID 68739135
4-[2-hydroxy-2-(propylamino)ethyl]benzene-1,2-diol (PubChem CID 68739135) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[2-hydroxy-2-(propylamino)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-hydroxy-2-(propylamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 68739135 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-[2-hydroxy-2-(propylamino)ethyl]benzene-1,2-diol |
| SMILES | CCCNC(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H17NO3/c1-2-5-12-11(15)7-8-3-4-9(13)10(14)6-8/h3-4,6,11-15H,2,5,7H2,1H3 |
| InChIKey | GYRSXVVJTQADBE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|