C9H12N2O4 — CID 53245952
3-(3,4-dihydroxyphenyl)-2-hydroxypropanehydrazide (PubChem CID 53245952) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-hydroxypropanehydrazide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-hydroxypropanehydrazide |
|---|---|
| PubChem CID | 53245952 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-hydroxypropanehydrazide |
| SMILES | NNC(=O)C(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H12N2O4/c10-11-9(15)8(14)4-5-1-2-6(12)7(13)3-5/h1-3,8,12-14H,4,10H2,(H,11,15) |
| InChIKey | GZLXHNWBNMWDIZ-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|