C22H30O6 — CID 172869117
4-[(2S,5S)-2-[(2S,3S)-1-(3,4-dihydroxyphenyl)-3-hydroxybutan-2-yl]-5-hydroxyhexyl]benzene-1,2-diol (PubChem CID 172869117) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[(2S,5S)-2-[(2S,3S)-1-(3,4-dihydroxyphenyl)-3-hydroxybutan-2-yl]-5-hydroxyhexyl]benzene-1,2-diol.
| Compound Name | 4-[(2S,5S)-2-[(2S,3S)-1-(3,4-dihydroxyphenyl)-3-hydroxybutan-2-yl]-5-hydroxyhexyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 172869117 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 4-[(2S,5S)-2-[(2S,3S)-1-(3,4-dihydroxyphenyl)-3-hydroxybutan-2-yl]-5-hydroxyhexyl]benzene-1,2-diol |
| SMILES | C[C@H](O)CC[C@@H](Cc1ccc(O)c(O)c1)[C@H](Cc1ccc(O)c(O)c1)[C@H](C)O |
| InChI | InChI=1S/C22H30O6/c1-13(23)3-6-17(9-15-4-7-19(25)21(27)11-15)18(14(2)24)10-16-5-8-20(26)22(28)12-16/h4-5,7-8,11-14,17-18,23-28H,3,6,9-10H2,1-2H3/t13-,14-,17-,18+/m0/s1 |
| InChIKey | SPGHLACPRUEAIC-DFEHZGFQSA-N |
| XLogP | 3.07 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|