C44H60O8 — CID 172869203
(2S,3S,4S,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol;(2S,3R,4R,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol (PubChem CID 172869203) has the molecular formula C44H60O8 and a molecular weight of 716.96 g/mol. Its IUPAC name is (2S,3S,4S,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol;(2S,3R,4R,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol.
| Compound Name | (2S,3S,4S,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol;(2S,3R,4R,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol |
|---|---|
| PubChem CID | 172869203 |
| Molecular Formula | C44H60O8 |
| Molecular Weight | 716.96 g/mol |
| Exact Mass | 716.43 |
| IUPAC Name | (2S,3S,4S,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol;(2S,3R,4R,7S)-3,4-bis[(3-hydroxyphenyl)methyl]octane-2,7-diol |
| SMILES | C[C@H](O)CC[C@@H](Cc1cccc(O)c1)[C@H](Cc1cccc(O)c1)[C@H](C)O.C[C@H](O)CC[C@H](Cc1cccc(O)c1)[C@@H](Cc1cccc(O)c1)[C@H](C)O |
| InChI | InChI=1S/2C22H30O4/c2*1-15(23)9-10-19(11-17-5-3-7-20(25)12-17)22(16(2)24)14-18-6-4-8-21(26)13-18/h2*3-8,12-13,15-16,19,22-26H,9-11,14H2,1-2H3/t15-,16-,19+,22-;15-,16-,19-,22+/m00/s1 |
| InChIKey | IJQGTPVXVREXKV-GRBGQSJYSA-N |
| XLogP | 7.31 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.96 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |